C19H21ClO5 — CID 22687920
3-[3-[2-(4-chloro-3-methylphenoxy)ethoxy]-4-methoxyphenyl]propanoic acid (PubChem CID 22687920) has the molecular formula C19H21ClO5 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-[3-[2-(4-chloro-3-methylphenoxy)ethoxy]-4-methoxyphenyl]propanoic acid.
| Compound Name | 3-[3-[2-(4-chloro-3-methylphenoxy)ethoxy]-4-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 22687920 |
| Molecular Formula | C19H21ClO5 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[3-[2-(4-chloro-3-methylphenoxy)ethoxy]-4-methoxyphenyl]propanoic acid |
| SMILES | COc1ccc(CCC(=O)O)cc1OCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C19H21ClO5/c1-13-11-15(5-6-16(13)20)24-9-10-25-18-12-14(4-8-19(21)22)3-7-17(18)23-2/h3,5-7,11-12H,4,8-10H2,1-2H3,(H,21,22) |
| InChIKey | NEAOESLJSMMEFG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|