C22H21ClO4 — CID 22685443
3-[2-[2-(4-chloro-3-methylphenoxy)ethoxy]naphthalen-1-yl]propanoic acid (PubChem CID 22685443) has the molecular formula C22H21ClO4 and a molecular weight of 384.86 g/mol. Its IUPAC name is 3-[2-[2-(4-chloro-3-methylphenoxy)ethoxy]naphthalen-1-yl]propanoic acid.
| Compound Name | 3-[2-[2-(4-chloro-3-methylphenoxy)ethoxy]naphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 22685443 |
| Molecular Formula | C22H21ClO4 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-[2-[2-(4-chloro-3-methylphenoxy)ethoxy]naphthalen-1-yl]propanoic acid |
| SMILES | Cc1cc(OCCOc2ccc3ccccc3c2CCC(=O)O)ccc1Cl |
| InChI | InChI=1S/C22H21ClO4/c1-15-14-17(7-9-20(15)23)26-12-13-27-21-10-6-16-4-2-3-5-18(16)19(21)8-11-22(24)25/h2-7,9-10,14H,8,11-13H2,1H3,(H,24,25) |
| InChIKey | HTLCXDHAUUHLDL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|