C30H32O6 — CID 138543521
5-naphthalen-1-yloxypentanoic acid;5-naphthalen-2-yloxypentanoic acid (PubChem CID 138543521) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is 5-naphthalen-1-yloxypentanoic acid;5-naphthalen-2-yloxypentanoic acid.
| Compound Name | 5-naphthalen-1-yloxypentanoic acid;5-naphthalen-2-yloxypentanoic acid |
|---|---|
| PubChem CID | 138543521 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 5-naphthalen-1-yloxypentanoic acid;5-naphthalen-2-yloxypentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc2ccccc2c1.O=C(O)CCCCOc1cccc2ccccc12 |
| InChI | InChI=1S/2C15H16O3/c16-15(17)10-3-4-11-18-14-9-5-7-12-6-1-2-8-13(12)14;16-15(17)7-3-4-10-18-14-9-8-12-5-1-2-6-13(12)11-14/h1-2,5-9H,3-4,10-11H2,(H,16,17);1-2,5-6,8-9,11H,3-4,7,10H2,(H,16,17) |
| InChIKey | KXLLFVRDNQXJSX-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|