C17H20O3 — CID 39371628
7-naphthalen-2-yloxyheptanoic acid (PubChem CID 39371628) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 7-naphthalen-2-yloxyheptanoic acid.
| Compound Name | 7-naphthalen-2-yloxyheptanoic acid |
|---|---|
| PubChem CID | 39371628 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 7-naphthalen-2-yloxyheptanoic acid |
| SMILES | O=C(O)CCCCCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H20O3/c18-17(19)9-3-1-2-6-12-20-16-11-10-14-7-4-5-8-15(14)13-16/h4-5,7-8,10-11,13H,1-3,6,9,12H2,(H,18,19) |
| InChIKey | QSYVSTGGSPDQER-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|