C21H30O2 — CID 164916130
11-naphthalen-2-yloxyundecan-1-ol (PubChem CID 164916130) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 11-naphthalen-2-yloxyundecan-1-ol.
| Compound Name | 11-naphthalen-2-yloxyundecan-1-ol |
|---|---|
| PubChem CID | 164916130 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 11-naphthalen-2-yloxyundecan-1-ol |
| SMILES | OCCCCCCCCCCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H30O2/c22-16-10-6-4-2-1-3-5-7-11-17-23-21-15-14-19-12-8-9-13-20(19)18-21/h8-9,12-15,18,22H,1-7,10-11,16-17H2 |
| InChIKey | MWQNUUXSNZAWNC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|