C30H38O5 — CID 142555258
7-naphthalen-2-yloxyhept-1-en-2-ol;7-phenoxyheptanoic acid (PubChem CID 142555258) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is 7-naphthalen-2-yloxyhept-1-en-2-ol;7-phenoxyheptanoic acid.
| Compound Name | 7-naphthalen-2-yloxyhept-1-en-2-ol;7-phenoxyheptanoic acid |
|---|---|
| PubChem CID | 142555258 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 7-naphthalen-2-yloxyhept-1-en-2-ol;7-phenoxyheptanoic acid |
| SMILES | C=C(O)CCCCCOc1ccc2ccccc2c1.O=C(O)CCCCCCOc1ccccc1 |
| InChI | InChI=1S/C17H20O2.C13H18O3/c1-14(18)7-3-2-6-12-19-17-11-10-15-8-4-5-9-16(15)13-17;14-13(15)10-6-1-2-7-11-16-12-8-4-3-5-9-12/h4-5,8-11,13,18H,1-3,6-7,12H2;3-5,8-9H,1-2,6-7,10-11H2,(H,14,15) |
| InChIKey | VFASFZZFNWVLJD-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|