C22H28O3 — CID 67166599
8-naphthalen-2-yloxyoctyl 2-methylprop-2-enoate (PubChem CID 67166599) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 8-naphthalen-2-yloxyoctyl 2-methylprop-2-enoate.
| Compound Name | 8-naphthalen-2-yloxyoctyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67166599 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 8-naphthalen-2-yloxyoctyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H28O3/c1-18(2)22(23)25-16-10-6-4-3-5-9-15-24-21-14-13-19-11-7-8-12-20(19)17-21/h7-8,11-14,17H,1,3-6,9-10,15-16H2,2H3 |
| InChIKey | RYXGQHHGGUYCGP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|