C31H30O6 — CID 139533290
2-naphthalen-2-yloxyethyl 2-methylprop-2-enoate;2-naphthalen-2-yloxyethyl prop-2-enoate (PubChem CID 139533290) has the molecular formula C31H30O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-naphthalen-2-yloxyethyl 2-methylprop-2-enoate;2-naphthalen-2-yloxyethyl prop-2-enoate.
| Compound Name | 2-naphthalen-2-yloxyethyl 2-methylprop-2-enoate;2-naphthalen-2-yloxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 139533290 |
| Molecular Formula | C31H30O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2-naphthalen-2-yloxyethyl 2-methylprop-2-enoate;2-naphthalen-2-yloxyethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc2ccccc2c1.C=CC(=O)OCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H16O3.C15H14O3/c1-12(2)16(17)19-10-9-18-15-8-7-13-5-3-4-6-14(13)11-15;1-2-15(16)18-10-9-17-14-8-7-12-5-3-4-6-13(12)11-14/h3-8,11H,1,9-10H2,2H3;2-8,11H,1,9-10H2 |
| InChIKey | MDRZLSJQYWPKDC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|