C27H34O5 — CID 66750102
butyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate;styrene (PubChem CID 66750102) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate;styrene.
| Compound Name | butyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate;styrene |
|---|---|
| PubChem CID | 66750102 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OCCCC.C=CC(=O)OCCOc1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C11H12O3.C8H14O2.C8H8/c1-2-11(12)14-9-8-13-10-6-4-3-5-7-10;1-4-5-6-10-8(9)7(2)3;1-2-8-6-4-3-5-7-8/h2-7H,1,8-9H2;2,4-6H2,1,3H3;2-7H,1H2 |
| InChIKey | WNEOPCDPTXMGHK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|