C27H38O6 — CID 70224354
5-butoxycarbonyl-2-methylhexa-2,5-dienoic acid;butyl prop-2-enoate;styrene (PubChem CID 70224354) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is 5-butoxycarbonyl-2-methylhexa-2,5-dienoic acid;butyl prop-2-enoate;styrene.
| Compound Name | 5-butoxycarbonyl-2-methylhexa-2,5-dienoic acid;butyl prop-2-enoate;styrene |
|---|---|
| PubChem CID | 70224354 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 5-butoxycarbonyl-2-methylhexa-2,5-dienoic acid;butyl prop-2-enoate;styrene |
| SMILES | C=C(CC=C(C)C(=O)O)C(=O)OCCCC.C=CC(=O)OCCCC.C=Cc1ccccc1 |
| InChI | InChI=1S/C12H18O4.C8H8.C7H12O2/c1-4-5-8-16-12(15)10(3)7-6-9(2)11(13)14;1-2-8-6-4-3-5-7-8;1-3-5-6-9-7(8)4-2/h6H,3-5,7-8H2,1-2H3,(H,13,14);2-7H,1H2;4H,2-3,5-6H2,1H3 |
| InChIKey | RJPWIUUOOXXOMC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|