C25H30O2 — CID 6454035
1,2-bis(ethenyl)benzene;butyl prop-2-enoate;styrene (PubChem CID 6454035) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;butyl prop-2-enoate;styrene.
| Compound Name | 1,2-bis(ethenyl)benzene;butyl prop-2-enoate;styrene |
|---|---|
| PubChem CID | 6454035 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;butyl prop-2-enoate;styrene |
| SMILES | C=CC(=O)OCCCC.C=Cc1ccccc1.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C8H8.C7H12O2/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;1-3-5-6-9-7(8)4-2/h3-8H,1-2H2;2-7H,1H2;4H,2-3,5-6H2,1H3 |
| InChIKey | IWBUOAHJGJZERP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|