C20H25F3O4 — CID 67725211
butyl prop-2-enoate;styrene;2,2,2-trifluoroethyl prop-2-enoate (PubChem CID 67725211) has the molecular formula C20H25F3O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is butyl prop-2-enoate;styrene;2,2,2-trifluoroethyl prop-2-enoate.
| Compound Name | butyl prop-2-enoate;styrene;2,2,2-trifluoroethyl prop-2-enoate |
|---|---|
| PubChem CID | 67725211 |
| Molecular Formula | C20H25F3O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | butyl prop-2-enoate;styrene;2,2,2-trifluoroethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)F.C=CC(=O)OCCCC.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C7H12O2.C5H5F3O2/c1-2-8-6-4-3-5-7-8;1-3-5-6-9-7(8)4-2;1-2-4(9)10-3-5(6,7)8/h2-7H,1H2;4H,2-3,5-6H2,1H3;2H,1,3H2 |
| InChIKey | ZRUCLWHBOPGXQT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|