C19H23F3O5 — CID 174793037
2-hydroxyethyl prop-2-enoate;styrene;2,2,2-trifluoroethyl 2-methylprop-2-enoate (PubChem CID 174793037) has the molecular formula C19H23F3O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;styrene;2,2,2-trifluoroethyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxyethyl prop-2-enoate;styrene;2,2,2-trifluoroethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174793037 |
| Molecular Formula | C19H23F3O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;styrene;2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)F.C=CC(=O)OCCO.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C6H7F3O2.C5H8O3/c1-2-8-6-4-3-5-7-8;1-4(2)5(10)11-3-6(7,8)9;1-2-5(7)8-4-3-6/h2-7H,1H2;1,3H2,2H3;2,6H,1,3-4H2 |
| InChIKey | ZXCCFYIMJBQPOJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|