C21H26O4 — CID 68553077
prop-2-enyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene (PubChem CID 68553077) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is prop-2-enyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene.
| Compound Name | prop-2-enyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene |
|---|---|
| PubChem CID | 68553077 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | prop-2-enyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene |
| SMILES | C=CCOC(=O)C(=C)C.C=CCOC(=O)C=C.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C7H10O2.C6H8O2/c1-2-8-6-4-3-5-7-8;1-4-5-9-7(8)6(2)3;1-3-5-8-6(7)4-2/h2-7H,1H2;4H,1-2,5H2,3H3;3-4H,1-2,5H2 |
| InChIKey | TXJCGSRPDIKISQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|