C26H35NO4 — CID 69095633
2-[bis(prop-2-enyl)amino]ethyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene (PubChem CID 69095633) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]ethyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene.
| Compound Name | 2-[bis(prop-2-enyl)amino]ethyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene |
|---|---|
| PubChem CID | 69095633 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]ethyl 2-methylprop-2-enoate;prop-2-enyl prop-2-enoate;styrene |
| SMILES | C=CCN(CC=C)CCOC(=O)C(=C)C.C=CCOC(=O)C=C.C=Cc1ccccc1 |
| InChI | InChI=1S/C12H19NO2.C8H8.C6H8O2/c1-5-7-13(8-6-2)9-10-15-12(14)11(3)4;1-2-8-6-4-3-5-7-8;1-3-5-8-6(7)4-2/h5-6H,1-3,7-10H2,4H3;2-7H,1H2;3-4H,1-2,5H2 |
| InChIKey | VIYGGWXCTFOMTP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|