C17H20O2 — CID 174791645
1,4-bis(ethenyl)benzene;prop-2-enyl 2-methylprop-2-enoate (PubChem CID 174791645) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1,4-bis(ethenyl)benzene;prop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 1,4-bis(ethenyl)benzene;prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174791645 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1,4-bis(ethenyl)benzene;prop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=CCOC(=O)C(=C)C.C=Cc1ccc(C=C)cc1 |
| InChI | InChI=1S/C10H10.C7H10O2/c1-3-9-5-7-10(4-2)8-6-9;1-4-5-9-7(8)6(2)3/h3-8H,1-2H2;4H,1-2,5H2,3H3 |
| InChIKey | NYAOSFWQLSBISJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|