About methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate
methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate (PubChem CID 175307353) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate |
| PubChem CID | 175307353 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(O)C(=O)OC.C=CCOC(=O)C(=C)C |
| InChI | InChI=1S/C7H10O2.C4H6O3/c1-4-5-9-7(8)6(2)3;1-3(5)4(6)7-2/h4H,1-2,5H2,3H3;5H,1H2,2H3 |
| InChIKey | BZXWJBVMLYKHSF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate?
The IUPAC name of methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate (CID 175307353) is methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate.
What is the SMILES notation for methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate?
The canonical SMILES for methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate is C=C(O)C(=O)OC.C=CCOC(=O)C(=C)C.
What is the InChIKey of methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate?
The InChIKey is BZXWJBVMLYKHSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2.C4H6O3/c1-4-5-9-7(8)6(2)3;1-3(5)4(6)7-2/h4H,1-2,5H2,3H3;5H,1H2,2H3.
What are the key properties of methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate?
methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate has a molecular weight of 228.24 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxyprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate is sourced from PubChem (CID 175307353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).