C22H37NO6 — CID 88724347
2-aminoethyl 3-ethyl-2-methylidenepentanoate;methyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate (PubChem CID 88724347) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol. Its IUPAC name is 2-aminoethyl 3-ethyl-2-methylidenepentanoate;methyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 2-aminoethyl 3-ethyl-2-methylidenepentanoate;methyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88724347 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-aminoethyl 3-ethyl-2-methylidenepentanoate;methyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C(=O)OCCN)C(CC)CC.C=C(C)C(=O)OC.C=CCOC(=O)C(=C)C |
| InChI | InChI=1S/C10H19NO2.C7H10O2.C5H8O2/c1-4-9(5-2)8(3)10(12)13-7-6-11;1-4-5-9-7(8)6(2)3;1-4(2)5(6)7-3/h9H,3-7,11H2,1-2H3;4H,1-2,5H2,3H3;1H2,2-3H3 |
| InChIKey | CGRJIPCWJNRPPT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|