About 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate)
2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) (PubChem CID 173405157) has the molecular formula C51H82O21
and a molecular weight of 1031.20 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate).
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) |
| PubChem CID | 173405157 |
| Molecular Formula | C51H82O21 |
| Molecular Weight | 1031.20 g/mol |
| Exact Mass | 1030.53 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OCCO |
| InChI | InChI=1S/C6H10O3.9C5H8O2/c1-5(2)6(8)9-4-3-7;9*1-4(2)5(6)7-3/h7H,1,3-4H2,2H3;9*1H2,2-3H3 |
| InChIKey | HBJHEDSAOOQMHA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 283.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1031.20 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 21 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate)?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) (CID 173405157) is 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate).
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate)?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) is C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OC.C=C(C)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate)?
The InChIKey is HBJHEDSAOOQMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.9C5H8O2/c1-5(2)6(8)9-4-3-7;9*1-4(2)5(6)7-3/h7H,1,3-4H2,2H3;9*1H2,2-3H3.
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate)?
2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) has a molecular weight of 1031.20 g/mol, XLogP of 6.72, 12 rotatable bonds, 1 hydrogen bond donors, and 21 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;nonakis(methyl 2-methylprop-2-enoate) is sourced from PubChem (CID 173405157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).