C15H24O7 — CID 161474315
3-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 161474315) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | 3-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 161474315 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCCO.C=CC(=O)O |
| InChI | InChI=1S/C7H12O3.C5H8O2.C3H4O2/c1-6(2)7(9)10-5-3-4-8;1-4(2)5(6)7-3;1-2-3(4)5/h8H,1,3-5H2,2H3;1H2,2-3H3;2H,1H2,(H,4,5) |
| InChIKey | WDMXYMTXNCBAMB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|