C15H24O7 — CID 156579745
dimethyl 2-methylidenepentanedioate;3-hydroxypropyl 2-methylprop-2-enoate (PubChem CID 156579745) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is dimethyl 2-methylidenepentanedioate;3-hydroxypropyl 2-methylprop-2-enoate.
| Compound Name | dimethyl 2-methylidenepentanedioate;3-hydroxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156579745 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | dimethyl 2-methylidenepentanedioate;3-hydroxypropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCO.C=C(CCC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C8H12O4.C7H12O3/c1-6(8(10)12-3)4-5-7(9)11-2;1-6(2)7(9)10-5-3-4-8/h1,4-5H2,2-3H3;8H,1,3-5H2,2H3 |
| InChIKey | TZLKDKZZBWCIAR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|