C10H14O5 — CID 140998471
1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate (PubChem CID 140998471) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate.
| Compound Name | 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate |
|---|---|
| PubChem CID | 140998471 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate |
| SMILES | C=C(C(=C)C(=O)OCCCO)C(=O)OC |
| InChI | InChI=1S/C10H14O5/c1-7(9(12)14-3)8(2)10(13)15-6-4-5-11/h11H,1-2,4-6H2,3H3 |
| InChIKey | CRBWFTZZWQBZFS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|