1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate

C10H14O5 — CID 140998471

IUPAC1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate
SMILESC=C(C(=C)C(=O)OCCCO)C(=O)OC
InChIInChI=1S/C10H14O5/c1-7(9(12)14-3)8(2)10(13)15-6-4-5-11/h11H,1-2,4-6H2,3H3
InChIKeyCRBWFTZZWQBZFS-UHFFFAOYSA-N
MW214.22 g/mol
LogP0.20
Rot. Bonds6

About 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate

1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate (PubChem CID 140998471) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate.

Molecular Properties

Compound Name1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate
PubChem CID140998471
Molecular FormulaC10H14O5
Molecular Weight214.22 g/mol
Exact Mass214.08
IUPAC Name1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate
SMILESC=C(C(=C)C(=O)OCCCO)C(=O)OC
InChIInChI=1S/C10H14O5/c1-7(9(12)14-3)8(2)10(13)15-6-4-5-11/h11H,1-2,4-6H2,3H3
InChIKeyCRBWFTZZWQBZFS-UHFFFAOYSA-N
XLogP0.20
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.22
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate?
The IUPAC name of 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate (CID 140998471) is 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate.
What is the SMILES notation for 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate?
The canonical SMILES for 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate is C=C(C(=C)C(=O)OCCCO)C(=O)OC.
What is the InChIKey of 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate?
The InChIKey is CRBWFTZZWQBZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5/c1-7(9(12)14-3)8(2)10(13)15-6-4-5-11/h11H,1-2,4-6H2,3H3.
What are the key properties of 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate?
1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate has a molecular weight of 214.22 g/mol, XLogP of 0.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(3-hydroxypropyl) 4-O-methyl 2,3-dimethylidenebutanedioate is sourced from PubChem (CID 140998471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).