C24H42O4 — CID 139708320
1-O-decyl 4-O-octyl 2,3-dimethylidenebutanedioate (PubChem CID 139708320) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 1-O-decyl 4-O-octyl 2,3-dimethylidenebutanedioate.
| Compound Name | 1-O-decyl 4-O-octyl 2,3-dimethylidenebutanedioate |
|---|---|
| PubChem CID | 139708320 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 1-O-decyl 4-O-octyl 2,3-dimethylidenebutanedioate |
| SMILES | C=C(C(=C)C(=O)OCCCCCCCCCC)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C24H42O4/c1-5-7-9-11-13-14-16-18-20-28-24(26)22(4)21(3)23(25)27-19-17-15-12-10-8-6-2/h3-20H2,1-2H3 |
| InChIKey | XGKQRRNFJRUHLD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|