C11H18O5 — CID 86583983
3-hydroxypropyl prop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 86583983) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-hydroxypropyl prop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | 3-hydroxypropyl prop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86583983 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-hydroxypropyl prop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)OCCCO |
| InChI | InChI=1S/C6H10O3.C5H8O2/c1-2-6(8)9-5-3-4-7;1-4(2)5(6)7-3/h2,7H,1,3-5H2;1H2,2-3H3 |
| InChIKey | UUCCPRNCCJBINL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|