About acetyl acetate;3-hydroxypropyl prop-2-enoate
acetyl acetate;3-hydroxypropyl prop-2-enoate (PubChem CID 146356068) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is acetyl acetate;3-hydroxypropyl prop-2-enoate.
Molecular Properties
| Compound Name | acetyl acetate;3-hydroxypropyl prop-2-enoate |
| PubChem CID | 146356068 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | acetyl acetate;3-hydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCO.CC(=O)OC(C)=O |
| InChI | InChI=1S/C6H10O3.C4H6O3/c1-2-6(8)9-5-3-4-7;1-3(5)7-4(2)6/h2,7H,1,3-5H2;1-2H3 |
| InChIKey | GUJREXBFBYJVQI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetyl acetate;3-hydroxypropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl acetate;3-hydroxypropyl prop-2-enoate?
The IUPAC name of acetyl acetate;3-hydroxypropyl prop-2-enoate (CID 146356068) is acetyl acetate;3-hydroxypropyl prop-2-enoate.
What is the SMILES notation for acetyl acetate;3-hydroxypropyl prop-2-enoate?
The canonical SMILES for acetyl acetate;3-hydroxypropyl prop-2-enoate is C=CC(=O)OCCCO.CC(=O)OC(C)=O.
What is the InChIKey of acetyl acetate;3-hydroxypropyl prop-2-enoate?
The InChIKey is GUJREXBFBYJVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H6O3/c1-2-6(8)9-5-3-4-7;1-3(5)7-4(2)6/h2,7H,1,3-5H2;1-2H3.
What are the key properties of acetyl acetate;3-hydroxypropyl prop-2-enoate?
acetyl acetate;3-hydroxypropyl prop-2-enoate has a molecular weight of 232.23 g/mol, XLogP of 0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl acetate;3-hydroxypropyl prop-2-enoate is sourced from PubChem (CID 146356068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).