C19H33NO7 — CID 158944800
2-(butylamino)ethyl 2-methylprop-2-enoate;3-hydroxypropyl prop-2-enoate;prop-2-enoic acid (PubChem CID 158944800) has the molecular formula C19H33NO7 and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-(butylamino)ethyl 2-methylprop-2-enoate;3-hydroxypropyl prop-2-enoate;prop-2-enoic acid.
| Compound Name | 2-(butylamino)ethyl 2-methylprop-2-enoate;3-hydroxypropyl prop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 158944800 |
| Molecular Formula | C19H33NO7 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-(butylamino)ethyl 2-methylprop-2-enoate;3-hydroxypropyl prop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCNCCCC.C=CC(=O)O.C=CC(=O)OCCCO |
| InChI | InChI=1S/C10H19NO2.C6H10O3.C3H4O2/c1-4-5-6-11-7-8-13-10(12)9(2)3;1-2-6(8)9-5-3-4-7;1-2-3(4)5/h11H,2,4-8H2,1,3H3;2,7H,1,3-5H2;2H,1H2,(H,4,5) |
| InChIKey | JKRMWGSRMCLMHV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|