C26H46O7 — CID 88758994
dodecyl 2-methylprop-2-enoate;4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate (PubChem CID 88758994) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is dodecyl 2-methylprop-2-enoate;4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate.
| Compound Name | dodecyl 2-methylprop-2-enoate;4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88758994 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | dodecyl 2-methylprop-2-enoate;4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCCCCCCCCCCC.C=C(CCO)C(=O)O |
| InChI | InChI=1S/C16H30O2.C5H8O3.C5H8O2/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-4(2-3-6)5(7)8;1-4(2)5(6)7-3/h2,4-14H2,1,3H3;6H,1-3H2,(H,7,8);1H2,2-3H3 |
| InChIKey | NYXMQTQZXYMVDI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|