C9H18O5 — CID 174925229
2-hydroxyethyl 2-methylprop-2-enoate;propane-1,1-diol (PubChem CID 174925229) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;propane-1,1-diol.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;propane-1,1-diol |
|---|---|
| PubChem CID | 174925229 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;propane-1,1-diol |
| SMILES | C=C(C)C(=O)OCCO.CCC(O)O |
| InChI | InChI=1S/C6H10O3.C3H8O2/c1-5(2)6(8)9-4-3-7;1-2-3(4)5/h7H,1,3-4H2,2H3;3-5H,2H2,1H3 |
| InChIKey | XUIIIDFJYFZMIQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|