C10H16O8 — CID 87085707
2-hydroxybutanedioic acid;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 87085707) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxybutanedioic acid;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87085707 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-hydroxybutanedioic acid;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C6H10O3.C4H6O5/c1-5(2)6(8)9-4-3-7;5-2(4(8)9)1-3(6)7/h7H,1,3-4H2,2H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | MVCBMGPCJURDQF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|