C10H20O9 — CID 174790415
2-hydroxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol (PubChem CID 174790415) has the molecular formula C10H20O9 and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol.
| Compound Name | 2-hydroxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 174790415 |
| Molecular Formula | C10H20O9 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-hydroxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
| SMILES | O=C(O)CC(O)C(=O)O.OCCOCCOCCO |
| InChI | InChI=1S/C6H14O4.C4H6O5/c7-1-3-9-5-6-10-4-2-8;5-2(4(8)9)1-3(6)7/h7-8H,1-6H2;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | VUIMOSZMNLIPNU-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|