C8H17NO7 — CID 23460146
2-hydroxybutanedioic acid;2-(2-hydroxyethylamino)ethanol (PubChem CID 23460146) has the molecular formula C8H17NO7 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 2-hydroxybutanedioic acid;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 23460146 |
| Molecular Formula | C8H17NO7 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-hydroxybutanedioic acid;2-(2-hydroxyethylamino)ethanol |
| SMILES | O=C(O)CC(O)C(=O)O.OCCNCCO |
| InChI | InChI=1S/C4H11NO2.C4H6O5/c6-3-1-5-2-4-7;5-2(4(8)9)1-3(6)7/h5-7H,1-4H2;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | JZRCOIIEOAJTLT-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|