C16H36N2O11 — CID 173189047
bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-hydroxybutanedioic acid (PubChem CID 173189047) has the molecular formula C16H36N2O11 and a molecular weight of 432.47 g/mol. Its IUPAC name is bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-hydroxybutanedioic acid.
| Compound Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 173189047 |
| Molecular Formula | C16H36N2O11 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)C(=O)O.OCCN(CCO)CCO.OCCN(CCO)CCO |
| InChI | InChI=1S/2C6H15NO3.C4H6O5/c2*8-4-1-7(2-5-9)3-6-10;5-2(4(8)9)1-3(6)7/h2*8-10H,1-6H2;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | WCDDDRJHCFEFJF-UHFFFAOYSA-N |
| XLogP | -4.56 |
| TPSA | 222.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |