About 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium
2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium (PubChem CID 87438440) has the molecular formula C9H21NO6Ti
and a molecular weight of 287.13 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium |
| PubChem CID | 87438440 |
| Molecular Formula | C9H21NO6Ti |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium |
| SMILES | CC(O)C(=O)O.OCCN(CCO)CCO.[Ti] |
| InChI | InChI=1S/C6H15NO3.C3H6O3.Ti/c8-4-1-7(2-5-9)3-6-10;1-2(4)3(5)6;/h8-10H,1-6H2;2,4H,1H3,(H,5,6); |
| InChIKey | VWIHIEKRIOCFBN-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium (CID 87438440) is 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium is CC(O)C(=O)O.OCCN(CCO)CCO.[Ti].
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium?
The InChIKey is VWIHIEKRIOCFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C3H6O3.Ti/c8-4-1-7(2-5-9)3-6-10;1-2(4)3(5)6;/h8-10H,1-6H2;2,4H,1H3,(H,5,6);.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium?
2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium has a molecular weight of 287.13 g/mol, XLogP of -2.29, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxypropanoic acid;titanium is sourced from PubChem (CID 87438440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).