About CID 11776805
CID 11776805 (PubChem CID 11776805) has the molecular formula C6H12GeO6
and a molecular weight of 252.77 g/mol.
Molecular Properties
| Compound Name | CID 11776805 |
| PubChem CID | 11776805 |
| Molecular Formula | C6H12GeO6 |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | — |
| SMILES | C[C@H](O)C(=O)O.C[C@H](O)C(=O)O.[Ge] |
| InChI | InChI=1S/2C3H6O3.Ge/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/t2*2-;/m00./s1 |
| InChIKey | DEBZPHLFVALRNF-CEOVSRFSSA-N |
| XLogP | -1.48 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11776805 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11776805?
The IUPAC name of CID 11776805 (CID 11776805) is not available.
What is the SMILES notation for CID 11776805?
The canonical SMILES for CID 11776805 is C[C@H](O)C(=O)O.C[C@H](O)C(=O)O.[Ge].
What is the InChIKey of CID 11776805?
The InChIKey is DEBZPHLFVALRNF-CEOVSRFSSA-N. The full InChI is InChI=1S/2C3H6O3.Ge/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/t2*2-;/m00./s1.
What are the key properties of CID 11776805?
CID 11776805 has a molecular weight of 252.77 g/mol, XLogP of -1.48, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11776805 is sourced from PubChem (CID 11776805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).