About 2-hydroxypropanoic acid;mercury
2-hydroxypropanoic acid;mercury (PubChem CID 88512020) has the molecular formula C3H6HgO3
and a molecular weight of 290.67 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;mercury.
Molecular Properties
| Compound Name | 2-hydroxypropanoic acid;mercury |
| PubChem CID | 88512020 |
| Molecular Formula | C3H6HgO3 |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2-hydroxypropanoic acid;mercury |
| SMILES | CC(O)C(=O)O.[Hg] |
| InChI | InChI=1S/C3H6O3.Hg/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6); |
| InChIKey | ZNQPQJBWQGULNQ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoic acid;mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoic acid;mercury?
The IUPAC name of 2-hydroxypropanoic acid;mercury (CID 88512020) is 2-hydroxypropanoic acid;mercury.
What is the SMILES notation for 2-hydroxypropanoic acid;mercury?
The canonical SMILES for 2-hydroxypropanoic acid;mercury is CC(O)C(=O)O.[Hg].
What is the InChIKey of 2-hydroxypropanoic acid;mercury?
The InChIKey is ZNQPQJBWQGULNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.Hg/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);.
What are the key properties of 2-hydroxypropanoic acid;mercury?
2-hydroxypropanoic acid;mercury has a molecular weight of 290.67 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoic acid;mercury is sourced from PubChem (CID 88512020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).