About CID 123133976
CID 123133976 (PubChem CID 123133976) has the molecular formula C6H12CaO6
and a molecular weight of 220.23 g/mol.
Molecular Properties
| Compound Name | CID 123133976 |
| PubChem CID | 123133976 |
| Molecular Formula | C6H12CaO6 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | — |
| SMILES | CC(O)C(=O)O.CC(O)C(=O)O.[Ca] |
| InChI | InChI=1S/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6); |
| InChIKey | PHAKCDFFYZFSEV-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 123133976 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123133976?
The IUPAC name of CID 123133976 (CID 123133976) is not available.
What is the SMILES notation for CID 123133976?
The canonical SMILES for CID 123133976 is CC(O)C(=O)O.CC(O)C(=O)O.[Ca].
What is the InChIKey of CID 123133976?
The InChIKey is PHAKCDFFYZFSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);.
What are the key properties of CID 123133976?
CID 123133976 has a molecular weight of 220.23 g/mol, XLogP of -1.48, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123133976 is sourced from PubChem (CID 123133976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).