About CID 131877347
CID 131877347 (PubChem CID 131877347) has the molecular formula C6H12O6Sr
and a molecular weight of 267.78 g/mol.
Molecular Properties
| Compound Name | CID 131877347 |
| PubChem CID | 131877347 |
| Molecular Formula | C6H12O6Sr |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | — |
| SMILES | CC(O)C(=O)O.CC(O)C(=O)O.[Sr] |
| InChI | InChI=1S/2C3H6O3.Sr/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6); |
| InChIKey | IVSAPIPLJDIPAY-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 131877347 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131877347?
The IUPAC name of CID 131877347 (CID 131877347) is not available.
What is the SMILES notation for CID 131877347?
The canonical SMILES for CID 131877347 is CC(O)C(=O)O.CC(O)C(=O)O.[Sr].
What is the InChIKey of CID 131877347?
The InChIKey is IVSAPIPLJDIPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H6O3.Sr/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);.
What are the key properties of CID 131877347?
CID 131877347 has a molecular weight of 267.78 g/mol, XLogP of -1.48, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131877347 is sourced from PubChem (CID 131877347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).