About 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol
2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol (PubChem CID 87290757) has the molecular formula C9H24NO6Ti
and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol |
| PubChem CID | 87290757 |
| Molecular Formula | C9H24NO6Ti |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol |
| SMILES | CC(C)O.O=[Ti]O.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C3H8O.H2O.O.Ti/c8-4-1-7(2-5-9)3-6-10;1-3(2)4;;;/h8-10H,1-6H2;3-4H,1-2H3;1H2;;/q;;;;+1/p-1 |
| InChIKey | WZZDHVAVLFWOMA-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol (CID 87290757) is 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol is CC(C)O.O=[Ti]O.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol?
The InChIKey is WZZDHVAVLFWOMA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15NO3.C3H8O.H2O.O.Ti/c8-4-1-7(2-5-9)3-6-10;1-3(2)4;;;/h8-10H,1-6H2;3-4H,1-2H3;1H2;;/q;;;;+1/p-1.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol?
2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol has a molecular weight of 290.16 g/mol, XLogP of -2.03, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;hydroxy(oxo)titanium;propan-2-ol is sourced from PubChem (CID 87290757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).