About 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol
2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol (PubChem CID 22218619) has the molecular formula C12H30N2O5
and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol |
| PubChem CID | 22218619 |
| Molecular Formula | C12H30N2O5 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol |
| SMILES | CC(O)CNCC(C)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C6H15NO2/c8-4-1-7(2-5-9)3-6-10;1-5(8)3-7-4-6(2)9/h8-10H,1-6H2;5-9H,3-4H2,1-2H3 |
| InChIKey | PQLPTXUJTJIXAB-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol (CID 22218619) is 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol is CC(O)CNCC(C)O.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol?
The InChIKey is PQLPTXUJTJIXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C6H15NO2/c8-4-1-7(2-5-9)3-6-10;1-5(8)3-7-4-6(2)9/h8-10H,1-6H2;5-9H,3-4H2,1-2H3.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol?
2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol has a molecular weight of 282.38 g/mol, XLogP of -2.40, 10 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;1-(2-hydroxypropylamino)propan-2-ol is sourced from PubChem (CID 22218619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).