About 1-(2-hydroxypropylamino)propan-2-ol;zinc
1-(2-hydroxypropylamino)propan-2-ol;zinc (PubChem CID 175137712) has the molecular formula C6H15NO2Zn
and a molecular weight of 198.58 g/mol. Its IUPAC name is 1-(2-hydroxypropylamino)propan-2-ol;zinc.
Molecular Properties
| Compound Name | 1-(2-hydroxypropylamino)propan-2-ol;zinc |
| PubChem CID | 175137712 |
| Molecular Formula | C6H15NO2Zn |
| Molecular Weight | 198.58 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 1-(2-hydroxypropylamino)propan-2-ol;zinc |
| SMILES | CC(O)CNCC(C)O.[Zn] |
| InChI | InChI=1S/C6H15NO2.Zn/c1-5(8)3-7-4-6(2)9;/h5-9H,3-4H2,1-2H3; |
| InChIKey | DVBDUOWWELSMJZ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.58 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxypropylamino)propan-2-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxypropylamino)propan-2-ol;zinc?
The IUPAC name of 1-(2-hydroxypropylamino)propan-2-ol;zinc (CID 175137712) is 1-(2-hydroxypropylamino)propan-2-ol;zinc.
What is the SMILES notation for 1-(2-hydroxypropylamino)propan-2-ol;zinc?
The canonical SMILES for 1-(2-hydroxypropylamino)propan-2-ol;zinc is CC(O)CNCC(C)O.[Zn].
What is the InChIKey of 1-(2-hydroxypropylamino)propan-2-ol;zinc?
The InChIKey is DVBDUOWWELSMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.Zn/c1-5(8)3-7-4-6(2)9;/h5-9H,3-4H2,1-2H3;.
What are the key properties of 1-(2-hydroxypropylamino)propan-2-ol;zinc?
1-(2-hydroxypropylamino)propan-2-ol;zinc has a molecular weight of 198.58 g/mol, XLogP of -0.66, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxypropylamino)propan-2-ol;zinc is sourced from PubChem (CID 175137712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).