C6H14N2O3 — CID 106174936
2-hydroxy-3-[[(2R)-2-hydroxypropyl]amino]propanamide (PubChem CID 106174936) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-hydroxy-3-[[(2R)-2-hydroxypropyl]amino]propanamide.
| Compound Name | 2-hydroxy-3-[[(2R)-2-hydroxypropyl]amino]propanamide |
|---|---|
| PubChem CID | 106174936 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-hydroxy-3-[[(2R)-2-hydroxypropyl]amino]propanamide |
| SMILES | C[C@@H](O)CNCC(O)C(N)=O |
| InChI | InChI=1S/C6H14N2O3/c1-4(9)2-8-3-5(10)6(7)11/h4-5,8-10H,2-3H2,1H3,(H2,7,11)/t4-,5?/m1/s1 |
| InChIKey | BKQITZLMFWCCSE-CNZKWPKMSA-N |
| XLogP | -2.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |