C7H16N2O4S — CID 106174934
3-(2-ethylsulfonylethylamino)-2-hydroxypropanamide (PubChem CID 106174934) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-(2-ethylsulfonylethylamino)-2-hydroxypropanamide.
| Compound Name | 3-(2-ethylsulfonylethylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174934 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(2-ethylsulfonylethylamino)-2-hydroxypropanamide |
| SMILES | CCS(=O)(=O)CCNCC(O)C(N)=O |
| InChI | InChI=1S/C7H16N2O4S/c1-2-14(12,13)4-3-9-5-6(10)7(8)11/h6,9-10H,2-5H2,1H3,(H2,8,11) |
| InChIKey | VHTQWFGZFGUGOP-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|