C8H18N2O5S — CID 107258283
2-hydroxy-3-(2-propan-2-yloxyethylsulfonylamino)propanamide (PubChem CID 107258283) has the molecular formula C8H18N2O5S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-hydroxy-3-(2-propan-2-yloxyethylsulfonylamino)propanamide.
| Compound Name | 2-hydroxy-3-(2-propan-2-yloxyethylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 107258283 |
| Molecular Formula | C8H18N2O5S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-hydroxy-3-(2-propan-2-yloxyethylsulfonylamino)propanamide |
| SMILES | CC(C)OCCS(=O)(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C8H18N2O5S/c1-6(2)15-3-4-16(13,14)10-5-7(11)8(9)12/h6-7,10-11H,3-5H2,1-2H3,(H2,9,12) |
| InChIKey | AFHOVAZIDQBJCO-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |