C7H17N3O4S — CID 79594323
N'-hydroxy-2-(2-propan-2-yloxyethylsulfonylamino)ethanimidamide (PubChem CID 79594323) has the molecular formula C7H17N3O4S and a molecular weight of 239.30 g/mol. Its IUPAC name is N'-hydroxy-2-(2-propan-2-yloxyethylsulfonylamino)ethanimidamide.
| Compound Name | N'-hydroxy-2-(2-propan-2-yloxyethylsulfonylamino)ethanimidamide |
|---|---|
| PubChem CID | 79594323 |
| Molecular Formula | C7H17N3O4S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N'-hydroxy-2-(2-propan-2-yloxyethylsulfonylamino)ethanimidamide |
| SMILES | CC(C)OCCS(=O)(=O)NCC(N)=NO |
| InChI | InChI=1S/C7H17N3O4S/c1-6(2)14-3-4-15(12,13)9-5-7(8)10-11/h6,9,11H,3-5H2,1-2H3,(H2,8,10) |
| InChIKey | DEHHCZSHKYADKM-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|