C8H16ClNO3S — CID 115674519
N-(2-chloroprop-2-enyl)-2-propan-2-yloxyethanesulfonamide (PubChem CID 115674519) has the molecular formula C8H16ClNO3S and a molecular weight of 241.74 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2-propan-2-yloxyethanesulfonamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2-propan-2-yloxyethanesulfonamide |
|---|---|
| PubChem CID | 115674519 |
| Molecular Formula | C8H16ClNO3S |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2-propan-2-yloxyethanesulfonamide |
| SMILES | C=C(Cl)CNS(=O)(=O)CCOC(C)C |
| InChI | InChI=1S/C8H16ClNO3S/c1-7(2)13-4-5-14(11,12)10-6-8(3)9/h7,10H,3-6H2,1-2H3 |
| InChIKey | LIIMQKWZRVHLAX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |