C13H27N3O4S — CID 120598489
N-(2-methylpiperidin-4-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide (PubChem CID 120598489) has the molecular formula C13H27N3O4S and a molecular weight of 321.44 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 120598489 |
| Molecular Formula | C13H27N3O4S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide |
| SMILES | CC1CC(NC(=O)CNS(=O)(=O)CCOC(C)C)CCN1 |
| InChI | InChI=1S/C13H27N3O4S/c1-10(2)20-6-7-21(18,19)15-9-13(17)16-12-4-5-14-11(3)8-12/h10-12,14-15H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | PONOOBOKFVAXEW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |