C14H26N2O6S — CID 119229868
4-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 119229868) has the molecular formula C14H26N2O6S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119229868 |
| Molecular Formula | C14H26N2O6S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)OCCS(=O)(=O)NCC(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C14H26N2O6S/c1-10(2)22-7-8-23(20,21)15-9-13(17)16-12-5-3-11(4-6-12)14(18)19/h10-12,15H,3-9H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | HSMDGBCBODFOHV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |