C15H20F2N2O3S — CID 120601223
2-[4-(difluoromethylsulfonyl)phenyl]-N-(2-methylpiperidin-4-yl)acetamide (PubChem CID 120601223) has the molecular formula C15H20F2N2O3S and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfonyl)phenyl]-N-(2-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[4-(difluoromethylsulfonyl)phenyl]-N-(2-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 120601223 |
| Molecular Formula | C15H20F2N2O3S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-[4-(difluoromethylsulfonyl)phenyl]-N-(2-methylpiperidin-4-yl)acetamide |
| SMILES | CC1CC(NC(=O)Cc2ccc(S(=O)(=O)C(F)F)cc2)CCN1 |
| InChI | InChI=1S/C15H20F2N2O3S/c1-10-8-12(6-7-18-10)19-14(20)9-11-2-4-13(5-3-11)23(21,22)15(16)17/h2-5,10,12,15,18H,6-9H2,1H3,(H,19,20) |
| InChIKey | ILTCYWRERYARGG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |