C15H22ClN3O3S — CID 120600077
2-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-methylpiperidin-4-yl)acetamide (PubChem CID 120600077) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 120600077 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-methylpiperidin-4-yl)acetamide |
| SMILES | CC1CC(NC(=O)CN(C)S(=O)(=O)c2ccc(Cl)cc2)CCN1 |
| InChI | InChI=1S/C15H22ClN3O3S/c1-11-9-13(7-8-17-11)18-15(20)10-19(2)23(21,22)14-5-3-12(16)4-6-14/h3-6,11,13,17H,7-10H2,1-2H3,(H,18,20) |
| InChIKey | MQAMROLFQRXQSJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |