C14H20N2O3S — CID 8816780
N-cyclopropyl-2-[(4-ethylphenyl)sulfonyl-methylamino]acetamide (PubChem CID 8816780) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-cyclopropyl-2-[(4-ethylphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[(4-ethylphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 8816780 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-cyclopropyl-2-[(4-ethylphenyl)sulfonyl-methylamino]acetamide |
| SMILES | CCc1ccc(S(=O)(=O)N(C)CC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-3-11-4-8-13(9-5-11)20(18,19)16(2)10-14(17)15-12-6-7-12/h4-5,8-9,12H,3,6-7,10H2,1-2H3,(H,15,17) |
| InChIKey | RYCPCFXGRZZWSJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |